| Company Name: |
LANSPHARMA
|
| Tel: |
+91-9000766909 +91-9000766909 |
| Email: |
info@lanspharma.com |
| Products Intro: |
Product Name:S-(2-Chloro-3-nitrophenyl) O-ethyl carbonodithioate
CAS:2757553-87-8
Purity:98% Package:1 g, 10 g, 50 g, 100 g, 1 Kg
|
|
| | Carbonodithioic acid, S-(2-chloro-3-nitrophenyl) O-ethyl ester Basic information |
| | Carbonodithioic acid, S-(2-chloro-3-nitrophenyl) O-ethyl ester Chemical Properties |
| Boiling point | 377.7±42.0 °C(predicted) | | density | 1.47±0.1 g/cm3(Temp: 20 °C; Press: 760 Torr)(predicted) |
| | Carbonodithioic acid, S-(2-chloro-3-nitrophenyl) O-ethyl ester Usage And Synthesis |
| | Carbonodithioic acid, S-(2-chloro-3-nitrophenyl) O-ethyl ester Preparation Products And Raw materials |
|