|
| methyl 1-methyl-1H-pyrazole-5-carboxylate Basic information |
Product Name: | methyl 1-methyl-1H-pyrazole-5-carboxylate | Synonyms: | methyl 1-methyl-1H-pyrazole-5-carboxylate;1H-Pyrazole-5-carboxylic acid, 1-Methyl-, Methyl ester;Methyl 2-Methylpyrazole-3-carboxylate;Pyrazole-5-carboxylic acid, 1-Methyl-, Methyl ester;2-methyl-3-pyrazolecarboxylic acid methyl ester;2-methylpyrazole-3-carboxylic acid methyl ester;Methyl 1-methylpyrazole-5-carboxylate;2-Methyl-2H-Pyrazole-3-Carboxylic Acid Methyl Ester(WX618160) | CAS: | 17827-60-0 | MF: | C6H8N2O2 | MW: | 140.14 | EINECS: | | Product Categories: | | Mol File: | 17827-60-0.mol | ![methyl 1-methyl-1H-pyrazole-5-carboxylate Structure](CAS/GIF/17827-60-0.gif) |
| methyl 1-methyl-1H-pyrazole-5-carboxylate Chemical Properties |
Boiling point | 83-84 °C(Press: 12 Torr) | density | 1.18±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 0.47±0.10(Predicted) | InChI | InChI=1S/C6H8N2O2/c1-8-5(3-4-7-8)6(9)10-2/h3-4H,1-2H3 | InChIKey | CECCPWAWRYFLOA-UHFFFAOYSA-N | SMILES | N1(C)C(C(OC)=O)=CC=N1 |
| methyl 1-methyl-1H-pyrazole-5-carboxylate Usage And Synthesis |
| methyl 1-methyl-1H-pyrazole-5-carboxylate Preparation Products And Raw materials |
|