1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid manufacturers
- Benzyl-PEG4-acid
-
- $0.00 / 100mg
-
2024-10-24
- CAS:127457-64-1
- Min. Order:
- Purity:
- Supply Ability: 10g
- Benzyl-PEG4-acid
-
- $0.00 / 5g
-
2024-03-25
- CAS:127457-64-1
- Min. Order: 5g
- Purity: >98.00%
- Supply Ability: 5g
|
| | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid Basic information |
| Product Name: | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid | | Synonyms: | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid;Benzyl-PEG4-acid;1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid(WXPC0056);BnO-PEG3-CH2CH2COOH;BnO-(CH2CH2O)3-CH2CH2COOH;BnO-PEG3-CH2CH2COOH/4,7,10,13-Tetraoxatetradecanoic acid, 14-phenyl-;4,7,10,13-Tetraoxatetradecanoic acid, 14-phenyl-;3-[2-[2-(2-benzyloxyethoxy)ethoxy]ethoxy]propanoic acid | | CAS: | 127457-64-1 | | MF: | C16H24O6 | | MW: | 312.36 | | EINECS: | | | Product Categories: | | | Mol File: | 127457-64-1.mol |  |
| | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid Chemical Properties |
| Boiling point | 454.3±40.0 °C(Predicted) | | density | 1.138±0.06 g/cm3(Predicted) | | form | Liquid | | pka | 4.28±0.10(Predicted) | | color | Colorless to light yellow |
| | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid Usage And Synthesis |
| Description | Benzyl-PEG4-acid is a PEG linker containing a benzyl protecting group and a carboxylic acid group. Benzyl is an alcohol protecting group and can be removed via hydrogenolysis. The carboxylic acid group can react with primary amine groups in the presence of activators such as EDC or HATU to form a stable amide bond. |
| | 1-phenyl-2,5,8,11-tetraoxatetradecan-14-oicacid Preparation Products And Raw materials |
|