|
|
| | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane Basic information |
| Product Name: | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane | | Synonyms: | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane;C-NH-Boc-C-Bis-(C-PEG1-Boc);Propanoic acid, 3,3'-[[2-[[(1,1-dimethylethoxy)carbonyl]amino]-1,3-propanediyl]bis(oxy)]bis-, 1,1'-bis(1,1-dimethylethyl) ester;AUN03918;tert-butyl 3-[2-(tert-butoxycarbonylamino)-3-(3-tert-butoxy-3-oxo-propoxy)propoxy]propanoate | | CAS: | 1807503-91-8 | | MF: | C22H41NO8 | | MW: | 447.56 | | EINECS: | | | Product Categories: | | | Mol File: | 1807503-91-8.mol |  |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane Chemical Properties |
| Boiling point | 513.4±50.0 °C(Predicted) | | density | 1.055±0.06 g/cm3(Predicted) | | pka | 11.51±0.46(Predicted) |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane Usage And Synthesis |
| Biological Activity | C-NH-Boc-C-Bis-(C-PEG1-Boc) is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. | | References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
| | 2-(t-Butoxycarbonylamido)-1,3-bis (t-butoxycarbonylethoxy)propane Preparation Products And Raw materials |
|