Company Name: |
Sigma-Aldrich
|
Tel: |
021-61415566 800-8193336 |
Email: |
orderCN@merckgroup.com |
Products Intro: |
Product Name:Poly(ethylene glycol)-block-polylactide methyl ether Purity:PEG average Mn 350, PLA average Mn 1,000 Package:1G Remarks:659665-1G
|
Company Name: |
Riedel-de Haen AG
|
Tel: |
800 558-9160 |
Email: |
|
Products Intro: |
Purity:PEG average Mn 350, PLA average Mn 1,000
|
Company Name: |
SIGMA-RBI
|
Tel: |
800 736 3690 (Orders) |
Email: |
|
Products Intro: |
|
|
| PEG-B-PLA Basic information |
Product Name: | PEG-B-PLA | Synonyms: | Poly(ethylene glycol)-block-polylactide methyl ether PEG average Mn 350, PLA average Mn 1,000;POLY(ETHYLENE GLYCOL)-BLOCK-POLYLACTIDE METHYL ETHER;PEG-B-PLA | CAS: | | MF: | CH3O(CH2CH2O)x(COCHCH3O)yH | MW: | 0 | EINECS: | | Product Categories: | | Mol File: | Mol File | |
| PEG-B-PLA Chemical Properties |
| PEG-B-PLA Usage And Synthesis |
| PEG-B-PLA Preparation Products And Raw materials |
|