| Company Name: |
Xi'an Confluore Biological Technology Co., Ltd.
|
| Tel: |
+86-156-80926068 +86-15680926068 |
| Email: |
1924344760@qq.com |
| Products Intro: |
Product Name:Cl-C6-PEG1-O-CH2COOH
CAS:2231744-57-1
Purity:98% HPLC Package:10MG;25MG;50MG;100MG;1G;5G Remarks:For customers outside China,please use the website:www.confluore.com
|
| Company Name: |
Jilin Province Woda Biotechnology Co., Ltd.
|
| Tel: |
13504435624 |
| Email: |
1927928688@qq.com |
| Products Intro: |
Product Name:2-(2-((6-Chlorohexyl)oxy)ethoxy)acetic acid
CAS:2231744-57-1
Purity:99% HPLC Package:1克;5克;
|
| Company Name: |
Shanghai Kaiwei Chemical Technology Co., Ltd.
|
| Tel: |
021-58461859 15821823057 |
| Email: |
service@aiviche.com |
| Products Intro: |
Product Name:2-(2-((6-Chlorohexyl)oxy)ethoxy)acetic acid
CAS:2231744-57-1
Purity:95% Package:1g;1kg
|
Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]- manufacturers
- Cl-C6-PEG1-O-CH2COOH
-
- $0.00 / 1g
-
2024-03-25
- CAS:2231744-57-1
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]- Basic information |
| | Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]- Chemical Properties |
| Boiling point | 373.9±27.0 °C(Predicted) | | density | 1.124±0.06 g/cm3(Predicted) | | pka | 3.40±0.10(Predicted) | | InChI | InChI=1S/C10H19ClO4/c11-5-3-1-2-4-6-14-7-8-15-9-10(12)13/h1-9H2,(H,12,13) | | InChIKey | NFVRQBNHQOLQED-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCCCCCCl |
| | Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]- Usage And Synthesis |
| | Acetic acid, 2-[2-[(6-chlorohexyl)oxy]ethoxy]- Preparation Products And Raw materials |
|