| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:BocNH-(CH2)3O-PEG4-(CH2)3NH2
CAS:956472-77-8
Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
Beijing Jin Ming Biotechnology Co., Ltd.
|
| Tel: |
010-60605840 15801484223; |
| Email: |
psaitong@jm-bio.com |
| Products Intro: |
Product Name:N-Boc-C1-PEG5-C3-NH2
CAS:956472-77-8
Package:100mg Remarks: 试剂级
|
|
| | 6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester Basic information |
| Product Name: | 6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester | | Synonyms: | N-Boc-C1-PEG5-C3-NH2;6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester;BocNH-(CH2)3O-PEG4-(CH2)3NH2 | | CAS: | 956472-77-8 | | MF: | C19H40N2O7 | | MW: | 408.53 | | EINECS: | | | Product Categories: | | | Mol File: | 956472-77-8.mol |  |
| | 6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester Chemical Properties |
| Boiling point | 504.4±50.0 °C(Predicted) | | density | 1.047±0.06 g/cm3(Predicted) | | pka | 12.66±0.46(Predicted) |
| | 6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|
|
Tag:6,9,12,15,18-Pentaoxa-2-azaheneicosanoic acid, 21-amino-, 1,1-dimethylethyl ester(956472-77-8)
Related Product Information
|