| Company Name: |
Wuhan Yuxiang Medical Technology Co., Ltd.
|
| Tel: |
13971275651 |
| Email: |
sales@whyxpharma.com |
| Products Intro: |
Product Name:N-(4-Chloro-3-fluorophenyl)-2,3,5,6-tetramethylbenzenesulfonamide
CAS:2327635-46-9
Purity:95% HPLC Package:1g;5g;10g
|
| Company Name: |
Shaanxi Istare Biotechnology Co., Ltd.
|
| Tel: |
18682931470 |
| Email: |
2142355700@qq.com |
| Products Intro: |
Product Name:N-(4-Chloro-3-fluorophenyl)-2,3,5,6-tetramethylbenzenesulfonamide
CAS:2327635-46-9
Purity:98% Package:1g
|
|
| | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl- Basic information |
| Product Name: | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl- | | Synonyms: | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl-;N-(4-Chloro-3-fluorophenyl)-2,3,5,6-tetramethylbenzenesulfonamide | | CAS: | 2327635-46-9 | | MF: | C16H17ClFNO2S | | MW: | 341.83 | | EINECS: | | | Product Categories: | | | Mol File: | 2327635-46-9.mol |  |
| | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl- Chemical Properties |
| Boiling point | 474.2±55.0 °C(Predicted) | | density | 1.315±0.06 g/cm3(Predicted) | | pka | 7.20±0.10(Predicted) |
| | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl- Usage And Synthesis |
| | Benzenesulfonamide, N-(4-chloro-3-fluorophenyl)-2,3,5,6-tetramethyl- Preparation Products And Raw materials |
|