2,5-Dimethylphenylacetyl chloride manufacturers
|
| 2,5-Dimethylphenylacetyl chloride Basic information |
Product Name: | 2,5-Dimethylphenylacetyl chloride | Synonyms: | 2,5-Dimethylphenylacetyl chloride;Benzeneacetyl chloride, 2,5-dimethyl-;2,5-Dimethyl phenyl acetic chloride;2,5-DimethylphenylacetylChloride>2-(2,5-Dimethylphenyl)acetyl Chloride;2,5-Dimethylbenzeneacetyl chloride | CAS: | 55312-97-5 | MF: | C10H11ClO | MW: | 182.65 | EINECS: | | Product Categories: | | Mol File: | 55312-97-5.mol |  |
| 2,5-Dimethylphenylacetyl chloride Chemical Properties |
Boiling point | 260.3±19.0 °C(Predicted) | density | 1.11 | refractive index | 1.5290 to 1.5330 | form | clear liquid | color | Colorless to Yellow | InChI | InChI=1S/C10H11ClO/c1-7-3-4-8(2)9(5-7)6-10(11)12/h3-5H,6H2,1-2H3 | InChIKey | PZRANTBLOIKHJY-UHFFFAOYSA-N | SMILES | C1(CC(Cl)=O)=CC(C)=CC=C1C |
RIDADR | UN 3265 8/PG II | HazardClass | 8 | PackingGroup | II | HS Code | 2914790090 |
| 2,5-Dimethylphenylacetyl chloride Usage And Synthesis |
| 2,5-Dimethylphenylacetyl chloride Preparation Products And Raw materials |
|