| Company Name: |
Interbioscreen Ltd.
|
| Tel: |
+7 (49) 6524-0091 |
| Email: |
screen@ibscreen.chg.ru |
| Products Intro: |
CAS:204773-02-4
Purity:95% Package:1mg Remarks:C18H13ClN4O4
|
| Company Name: |
Specs
|
| Tel: |
+31 15 251 8111 |
| Email: |
info@specs.net |
| Products Intro: |
|
|
| | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide Basic information |
| Product Name: | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide | | Synonyms: | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide;Pyrido[1,2-a]benzimidazole-4-carboxamide, N-(4-chloro-2-nitrophenyl)-1,2,3,5-tetrahydro-3-oxo- | | CAS: | 204773-02-4 | | MF: | C18H13ClN4O4 | | MW: | 384.77 | | EINECS: | | | Product Categories: | | | Mol File: | 204773-02-4.mol | ![N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide Structure](CAS/20180711/GIF/204773-02-4.gif) |
| | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide Chemical Properties |
| Boiling point | 569.0±50.0 °C(Predicted) | | density | 1.59±0.1 g/cm3(Predicted) | | pka | 9.73±0.70(Predicted) |
| | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide Usage And Synthesis |
| | N-{4-chloro-2-nitrophenyl}-3-oxo-1,2,3,5-tetrahydropyrido[1,2-a]benzimidazole-4-carboxamide Preparation Products And Raw materials |
|