| Company Name: |
Meryer (Shanghai) Chemical Technology Co., Ltd.
|
| Tel: |
021-61259108 18621169085 |
| Email: |
market03@meryer.com |
| Products Intro: |
Product Name:4-MercaptoMethyl-piperidine-1-carboxylic acid tert-butyl ester
CAS:581060-27-7
Purity:97% Package:1g Remarks:A52200
|
|
| | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate | | Synonyms: | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate;4-Mercaptomethyl-piperidine-1-carboxylic acid tert-butyl ester;4-(Mercaptomethyl)-1-piperidinecarboxylic acid tert-butyl ester;1-Boc-4-(Mercaptomethyl);1-Boc-4-(MercaptoMethyl)piperidine;tert-butyl 4-(sulfanylmethyl)piperidine-1-carboxylate;1-Piperidinecarboxylic acid, 4-(mercaptomethyl)-, 1,1-dimethylethyl ester | | CAS: | 581060-27-7 | | MF: | C11H21NO2S | | MW: | 231.35 | | EINECS: | | | Product Categories: | | | Mol File: | 581060-27-7.mol |  |
| | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 316.9±15.0 °C(Predicted) | | density | 1.052 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 10.23±0.10(Predicted) | | InChI | InChI=1S/C11H21NO2S/c1-11(2,3)14-10(13)12-6-4-9(8-15)5-7-12/h9,15H,4-8H2,1-3H3 | | InChIKey | VEPAXJUGIFPJNK-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CS)CC1 |
| | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 4-(mercaptomethyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|