p,p'-Divinyl-1,2-diphenylethane manufacturers
|
| | p,p'-Divinyl-1,2-diphenylethane Basic information |
| Product Name: | p,p'-Divinyl-1,2-diphenylethane | | Synonyms: | p,p'-Divinyl-1,2-diphenylethane;1,2-Bis(4-vinylphenyl)ethane;Benzene,1,1'-(1,2-ethanediyl)bis[4-ethenyl-;Bibenzyl, 4,4-divinyl-;1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene;1,2-Bis(p-vinylphenyl)ethane;TIANFU 48174-52-3 p,p'-Divinyl-1,2-diphenylethane;1-ethenyl-4-[2-(4-ethenylphenyl)ethyl]benzene(BVPE) | | CAS: | 48174-52-3 | | MF: | C18H18 | | MW: | 234.34 | | EINECS: | | | Product Categories: | Chloromethy styrene | | Mol File: | 48174-52-3.mol |  |
| | p,p'-Divinyl-1,2-diphenylethane Chemical Properties |
| Melting point | 95.5-97.5 °C | | Boiling point | 345.0±22.0 °C(Predicted) | | density | 0.997±0.06 g/cm3(Predicted) | | InChI | InChI=1S/C18H18/c1-3-15-5-9-17(10-6-15)13-14-18-11-7-16(4-2)8-12-18/h3-12H,1-2,13-14H2 | | InChIKey | ZXLAFQNTMMFLSA-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C=C)C=C1)CC1=CC=C(C=C)C=C1 |
| | p,p'-Divinyl-1,2-diphenylethane Usage And Synthesis |
| | p,p'-Divinyl-1,2-diphenylethane Preparation Products And Raw materials |
|