- Siponimod
-
- $0.00 / 1KG
-
2022-09-30
- CAS:1378888-43-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- Siponimod
-
- $3.00 / 1KG
-
2020-02-06
- CAS:1378888-43-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| Product Name: | Siponimod | | Synonyms: | 1-(3-Ethyl-4-(hydroxymethyl)phenyl)ethanone;SIPO-013;Ethanone, 1-[3-ethyl-4-(hydroxymethyl)phenyl]-;1-(3-ethyl-4-(hydroxymethyl)phenyl)ethan-1-one;1-(3-Ethyl-4-(hydroxymethyl)phenyl)ethanone Ethanone;1-(3-Ethyl-4-hydroxymethylphenyl)ethanone
（Siponimod）;1-(3-ethyl-4-(hydroxymethyl)phenyl)ethan-1-on;1-(3-ethyl-4-(hydroxymethyl)phenyl)Phenyl)Ethanone | | CAS: | 1378888-43-7 | | MF: | C11H14O2 | | MW: | 178.23 | | EINECS: | | | Product Categories: | | | Mol File: | 1378888-43-7.mol |  |
| | Siponimod Chemical Properties |
| Boiling point | 331.9±37.0 °C(Predicted) | | density | 1.063±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 14.26±0.10(Predicted) | | InChI | InChI=1S/C11H14O2/c1-3-9-6-10(8(2)13)4-5-11(9)7-12/h4-6,12H,3,7H2,1-2H3 | | InChIKey | UAOSVSMWAUFYMM-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(CO)C(CC)=C1)C |
| | Siponimod Usage And Synthesis |
| Physical Form | Solid | | Uses | 1-3-Ethyl-4-(hydroxymethyl)-phenyl)ethanone is a reagent used in the prepration of Siponimod, it''s salts ans solid forms of the compound. |
| | Siponimod Preparation Products And Raw materials |
|