|
|
| | CS 2100 Basic information |
| Product Name: | CS 2100 | | Synonyms: | CS 2100;1-[[4-Ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-thienyl]methyl]-3-azetidinecarboxylic acid;3-Azetidinecarboxylic acid, 1-[[4-ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-2-thienyl]methyl]-;CS-2100 1-[[4-Ethyl-5-[5-(4-phenoxyphenyl)-1,2,4-oxadiazol-3-yl]-
2-thienyl]methyl]-3-azetidinecarboxylic acid;1-[[4-Ethyl-5-[5-(4-phenoxyphenyl)-1;4-oxadiazol-3-yl]-2-thienyl]methyl]-3-azetidinecarboxylic acid;inhibit,LPL Receptor,CS2100,Inhibitor,CS 2100,immunosuppressive efficacy,HvGR,CS-2100,Lysophospholipid Receptor,S1P3-sparing | | CAS: | 913827-99-3 | | MF: | C25H23N3O4S | | MW: | 461.53 | | EINECS: | | | Product Categories: | | | Mol File: | 913827-99-3.mol |  |
| | CS 2100 Chemical Properties |
| Boiling point | 648.0±65.0 °C(Predicted) | | density | 1.336±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | <2.31mg/ml in DMSO | | pka | 2.63±0.20(Predicted) | | form | Solid | | color | Off-white to light yellow | | InChI | InChI=1S/C25H23N3O4S/c1-2-16-12-21(15-28-13-18(14-28)25(29)30)33-22(16)23-26-24(32-27-23)17-8-10-20(11-9-17)31-19-6-4-3-5-7-19/h3-12,18H,2,13-15H2,1H3,(H,29,30) | | InChIKey | DWVJASHDNJMDNH-UHFFFAOYSA-N | | SMILES | N1(CC2SC(C3N=C(C4=CC=C(OC5=CC=CC=C5)C=C4)ON=3)=C(CC)C=2)CC(C(O)=O)C1 |
| | CS 2100 Usage And Synthesis |
| Uses | CS 2100 is a sphingosine-1-phosphate receptor 1 (S1P1) agonist (EC50 = 4.0 nM). Exhibits 5000-fold selectivity for human S1P1 over S1P3. Displays efficacy in a rat adjuvant-induced arthritis model. | | storage | Store at +4°C |
| | CS 2100 Preparation Products And Raw materials |
|