- Palvanil
-
- $0.00 / 1g
-
2019-02-01
- CAS:69693-13-6
- Min. Order: 1Kgs/plastic barrel
- Purity: 99%
- Supply Ability: 500kgs
|
| Palvanil Basic information |
Product Name: | Palvanil | Synonyms: | Palvanil;N-[(4-hydroxy-3-methoxyphenyl)methyl]hexadecanamide;anti-inflammation,inhibit,HEK-293,Inhibitor,anti-nociceptive,Palvanil;Hexadecanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]- | CAS: | 69693-13-6 | MF: | C24H41NO3 | MW: | 391.59 | EINECS: | | Product Categories: | | Mol File: | 69693-13-6.mol | ![Palvanil Structure](CAS/20180808/GIF/69693-13-6.gif) |
| Palvanil Chemical Properties |
Melting point | 83-85 °C | Boiling point | 565.4±40.0 °C(Predicted) | density | 0.983±0.06 g/cm3(Predicted) | pka | 9.76±0.20(Predicted) | InChI | InChI=1S/C24H41NO3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-24(27)25-20-21-17-18-22(26)23(19-21)28-2/h17-19,26H,3-16,20H2,1-2H3,(H,25,27) | InChIKey | SGEUEXJZQFSBNX-UHFFFAOYSA-N | SMILES | C(NCC1=CC=C(O)C(OC)=C1)(=O)CCCCCCCCCCCCCCC |
| Palvanil Usage And Synthesis |
| Palvanil Preparation Products And Raw materials |
|