1-bromocyclopentyl-o-chlorophenyl ketone manufacturers
|
| | 1-bromocyclopentyl-o-chlorophenyl ketone Basic information |
| Product Name: | 1-bromocyclopentyl-o-chlorophenyl ketone | | Synonyms: | 1-bromocyclopentyl-o-chlorophenyl ketone;(1-Bromocyclopentyl)(2-chlorophenyl) ketone;Einecs 229-803-6;Methanone, (1-broMocyclopentyl)(2-chlorophenyl)-;Esketamine Impurity 1;(1-bromocyclopentyl)(2-chlorophenyl)methanone(WXC03944);(1-bromocyclopentyl)(2-chlorophenyl)methanone;Esketamine Hydrochloride Impurity 6 | | CAS: | 6740-86-9 | | MF: | C12H12BrClO | | MW: | 287.58 | | EINECS: | 229-803-6 | | Product Categories: | 6740-86-9 | | Mol File: | 6740-86-9.mol |  |
| | 1-bromocyclopentyl-o-chlorophenyl ketone Chemical Properties |
| Boiling point | 111-114 °C(Press: 0.1 Torr) | | density | 1.509±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Oil | | color | Dark Red to Black | | InChI | InChI=1S/C12H12BrClO/c13-12(7-3-4-8-12)11(15)9-5-1-2-6-10(9)14/h1-2,5-6H,3-4,7-8H2 | | InChIKey | DDVNLGGCSRULIL-UHFFFAOYSA-N | | SMILES | C(C1(Br)CCCC1)(C1=CC=CC=C1Cl)=O |
| | 1-bromocyclopentyl-o-chlorophenyl ketone Usage And Synthesis |
| Chemical Properties | Pale-yellow to Yellow-brown Liquid. | | Uses | 1-Bromocyclopentyl 2-Chlorophenyl Ketone is a reactant in the dehydrohalogenation of axial 6-bromoketamine III and is also an intermediate in the synthesis of S-(-)-Norketamine (N692060). |
| | 1-bromocyclopentyl-o-chlorophenyl ketone Preparation Products And Raw materials |
|