|
| sec-butyl butyrate Basic information |
Product Name: | sec-butyl butyrate | Synonyms: | sec-butyl butyrate;Butanoic acid, 1-methylpropyl ester;Butyric acid 1-methylpropyl ester;Butyric acid sec-butyl ester;sec-Butyl Butyrate;sec-Butyl Butyrate > | CAS: | 819-97-6 | MF: | C8H16O2 | MW: | 144.21 | EINECS: | 212-465-9 | Product Categories: | | Mol File: | 819-97-6.mol | |
| sec-butyl butyrate Chemical Properties |
Melting point | -88.07°C (estimate) | Boiling point | 152°C(lit.) | density | 0.8836 (estimate) | refractive index | 1.4000-1.4040 | form | clear liquid | color | Colorless to Almost colorless | InChI | InChI=1S/C8H16O2/c1-4-6-8(9)10-7(3)5-2/h7H,4-6H2,1-3H3 | InChIKey | QJHDFBAAFGELLO-UHFFFAOYSA-N | SMILES | C(OC(C)CC)(=O)CCC | LogP | 2.667 (est) |
RIDADR | 3272 | HazardClass | 3 | PackingGroup | III | HS Code | 2915907098 |
| sec-butyl butyrate Usage And Synthesis |
Definition | ChEBI: A butyrate ester obtained by the formal condensation of butyric acid with butan-2-ol. |
| sec-butyl butyrate Preparation Products And Raw materials |
|