|
| 2'-(Trifluoromethyl)propiophenone Basic information |
| 2'-(Trifluoromethyl)propiophenone Chemical Properties |
Boiling point | 219-220 °C(lit.) | density | 1.214 g/mL at 25 °C(lit.) | refractive index | n20/D 1.461(lit.) | Fp | 214 °F | storage temp. | Sealed in dry,Room Temperature | Specific Gravity | 1.214 | BRN | 2263292 | InChI | InChI=1S/C10H9F3O/c1-2-9(14)7-5-3-4-6-8(7)10(11,12)13/h3-6H,2H2,1H3 | InChIKey | PUSBIOFSWWHNDD-UHFFFAOYSA-N | SMILES | C(C1=CC=CC=C1C(F)(F)F)(=O)CC | CAS DataBase Reference | 16185-96-9(CAS DataBase Reference) | NIST Chemistry Reference | 2-(Trifluoromethyl)propiophenone(16185-96-9) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36-24/25 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29147000 |
| 2'-(Trifluoromethyl)propiophenone Usage And Synthesis |
| 2'-(Trifluoromethyl)propiophenone Preparation Products And Raw materials |
|