|
|
| | N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide Basic information |
| | N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide Chemical Properties |
| Melting point | 333-335°C | | Boiling point | 566.95° C (Predicted) | | density | 1.516±0.06 g/cm3(Predicted) | | refractive index | n20D 1.72 (Predicted) | | storage temp. | Inert atmosphere,2-8°C | | solubility | DMSO (Slightly) | | pka | 10.92±0.70(Predicted) | | form | Solid | | color | Pale Yellow | | Water Solubility | Slightly soluble in water | | InChI | InChI=1S/C16H13Cl2N5OS/c1-8-4-3-5-10(17)14(8)23-15(24)11-7-19-16(25-11)22-13-6-12(18)20-9(2)21-13/h3-7H,1-2H3,(H,23,24)(H,19,20,21,22) | | InChIKey | LMXUWARKUIELGT-UHFFFAOYSA-N | | SMILES | S1C(C(NC2=C(C)C=CC=C2Cl)=O)=CN=C1NC1C=C(Cl)N=C(C)N=1 | | CAS DataBase Reference | 302964-08-5(CAS DataBase Reference) |
| | N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide Usage And Synthesis |
| Description | N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide is a pharmaceutical intermediate compound used as a synthetic intermediate for dasatinib. Dasatinib is a targeted anticancer drug used to treat chronic myeloid leukaemia (CML) and Philadelphia chromosome-positive acute lymphoblastic leukaemia (ALL). It is also a receptor and non-receptor Tyk (tyrosine kinase) inhibitor, which plays an important role in certain cancers and fibrotic diseases. | | Chemical Properties | Pale Yellow Solid | | Uses | Dasatinib intermediate. A protein tyrosine kinase inhibitor. |
| | N-(2-Chloro-6-methylphenyl)-2-[(6-chloro-2-methyl-4-pyrimidinyl)amino]-5-thiazolecarboxamide Preparation Products And Raw materials |
|