|
| Hexahydro-1-methyl-4H-azepin-4-one Basic information |
| Hexahydro-1-methyl-4H-azepin-4-one Chemical Properties |
Melting point | 115-120°C | Boiling point | 97-100°C | solubility | Chloroform (Slightly, Heated), DMSO (Slightly) | form | Solid | color | Light Brown to Brown | InChI | InChI=1S/C7H13NO.ClH/c1-8-5-2-3-7(9)4-6-8;/h2-6H2,1H3;1H | InChIKey | BHSJZGRGJYULPA-UHFFFAOYSA-N | SMILES | N1(C)CCCC(=O)CC1.[H]Cl | CAS DataBase Reference | 19869-42-2(CAS DataBase Reference) |
HazardClass | IRRITANT | HS Code | 2914390090 |
| Hexahydro-1-methyl-4H-azepin-4-one Usage And Synthesis |
Chemical Properties | colorless to light yellow liquid | Uses | 1-Methylazepan-4-One Hydrochloride is used in preparation of N-Methylhexahydroazepan-4-one Hydrochloride. | Synthesis Reference(s) | Synthetic Communications, 21, p. 881, 1991 DOI: 10.1080/00397919108019772 |
| Hexahydro-1-methyl-4H-azepin-4-one Preparation Products And Raw materials |
|