| Company Name: |
ChangZhou SIDU chemical Co., Ltd.
|
| Tel: |
0519-81291281 18015082300 |
| Email: |
siduchem@hotmail.com |
| Products Intro: |
Product Name:Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate
CAS:194924-94-2
Purity:95%
|
| Company Name: |
Shanghai Balmxy Pharmaceutical Co., Ltd
|
| Tel: |
021-24206007 13764915196 |
| Email: |
sales@balmxy.com |
| Products Intro: |
Product Name:β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-(2-methoxy-2-oxoethyl)-, methyl ester
CAS:194924-94-2
Purity:98%+ Package:5g;25g;100g;500g;1kg;5kg;25kg;100kg
|
| Company Name: |
Shanghai Na Qian Chemical Technology Co. Ltd.
|
| Tel: |
0373-7129549; 13598610367 |
| Email: |
2841375912@qq.com |
| Products Intro: |
Product Name:Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate
CAS:194924-94-2
Purity:98% Package:100g
|
|
| | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate Basic information |
| Product Name: | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate | | Synonyms: | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate;3-(tert-Butoxycarbonyl-methoxycarbonylmethyl-amino)-propionic acid methyl ester;β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-(2-methoxy-2-oxoethyl)-, methyl ester;β-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-(2-methoxy-2-oxoethyl)-, methyl ester | | CAS: | 194924-94-2 | | MF: | C12H21NO6 | | MW: | 275.3 | | EINECS: | | | Product Categories: | | | Mol File: | 194924-94-2.mol | ![Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate Structure](CAS/GIF/194924-94-2.gif) |
| | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate Chemical Properties |
| Boiling point | 345.3±35.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | pka | -2.12±0.70(Predicted) | | InChI | InChI=1S/C12H21NO6/c1-12(2,3)19-11(16)13(8-10(15)18-5)7-6-9(14)17-4/h6-8H2,1-5H3 | | InChIKey | OUSXWCJHYSNEEY-UHFFFAOYSA-N | | SMILES | C(=O)(OC(C)(C)C)N(CCC(OC)=O)CC(OC)=O |
| | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate Usage And Synthesis |
| | Methyl 3-[tert-butoxycarbonyl-(2-methoxy-2-oxo-ethyl)amino]propanoate Preparation Products And Raw materials |
|