| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Email: |
fisherwang@glschina.com |
| Products Intro: |
Product Name:(2S)-2-{[(tert-butoxy)carbonyl]amino}-3-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenyl}propanoic acid
CAS:959573-16-1
Purity:95%;98%;99% Package:0.1g, 0.25g, 1g, 5g, 10g, 25g, 50g, 100g
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:N-Boc-2-[(Fmoc-amino)methyl]-L-phenylalanine
CAS:959573-16-1
Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-66113011 18112977050 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:Boc-2-(Fmoc-aminomethyl)-L-phenylalanine
CAS:959573-16-1
Purity:95+% Package:1g;5g;10g
|
|
| | Boc-2-(Fmoc-aminomethyl)-L-Phe-OH Basic information |
| Product Name: | Boc-2-(Fmoc-aminomethyl)-L-Phe-OH | | Synonyms: | Boc-2-(Fmoc-aminomethyl)-L-phenylalanine≥ 98% (HPLC);Boc-2-(Fmoc-aminomethyl)-L-Phe-OH;Boc-L-Phe(2-CH2NHFmoc)-OH;Boc-2-(Fmoc-aminomethyl)-L-phenylalanine;(Tert-Butoxy)Carbonyl L-2-Aminomethylphe(Fmoc);(2S)-2-{[(tert-butoxy)carbonyl]amino}-3-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenyl}propanoic acid;N-α-(t-Butoxycarbonyl)-2-[(9-fluorenylmethoxycarbonyl)aminomethyl]-L-phenylalanine;N-Boc-2-[(Fmoc-amino)methyl]-L-phenylalanine | | CAS: | 959573-16-1 | | MF: | C30H32N2O6 | | MW: | 516.58 | | EINECS: | | | Product Categories: | | | Mol File: | 959573-16-1.mol |  |
| | Boc-2-(Fmoc-aminomethyl)-L-Phe-OH Chemical Properties |
| Boiling point | 729.5±60.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | pka | 3.89±0.11(Predicted) |
| | Boc-2-(Fmoc-aminomethyl)-L-Phe-OH Usage And Synthesis |
| Chemical Properties | White powder |
| | Boc-2-(Fmoc-aminomethyl)-L-Phe-OH Preparation Products And Raw materials |
|