| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL& Basic information |
| Product Name: | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL& | | Synonyms: | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL&;Zinc 2,3,9,10,16,17,23,24-octakis(octyloxy)-29H,31H-phthalocyanine Dye content 95 %;Zinc 2,3,9,10,16,17,23,24-octakis(octyloxy)-29H,31H-phthalocyanine | | CAS: | 261504-18-1 | | MF: | C96H144N8O8Zn | | MW: | 1603.63 | | EINECS: | | | Product Categories: | Infrared (IR) DyesPhotonic and Optical Materials;Organic Electronics and Photonics;Photonic and Optical Materials;Phthalocyanine and Porphyrin Dyes;Phthalocyanines | | Mol File: | 261504-18-1.mol |  |
| | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL& Chemical Properties |
| Melting point | >300 °C (lit.) | | form | solid | | λmax | 677 nm | | InChIKey | KEIALLXXQQVIQR-UHFFFAOYSA-N | | SMILES | CCCCCCCCOc1cc2c3nc(nc4n5[Zn]n6c(n3)c7cc(OCCCCCCCC)c(OCCCCCCCC)cc7c6nc8nc(nc5c9cc(OCCCCCCCC)c(OCCCCCCCC)cc49)c%10cc(OCCCCCCCC)c(OCCCCCCCC)cc8%10)c2cc1OCCCCCCCC |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL& Usage And Synthesis |
| | ZINC 2 3 9 10 16 17 23 24-OCTAKIS(OCTYL& Preparation Products And Raw materials |
|