| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride (1:1),(1R,4R)-
CAS:79645-15-1
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
- Sertraline ImpurityCl
-
- $0.00 / 10MG
-
2025-04-25
- CAS:79645-15-1
- Min. Order: 10MG
- Purity: 98
- Supply Ability: 100000000
|
| | Sertraline EP Impurity G Basic information |
| Product Name: | Sertraline EP Impurity G | | Synonyms: | SERTRALINE HCL;Sertraline IMpurity G HCl;(R,R)-Sertraline Hydrochloride;Sertraline Hydrochloride Impurity Ⅱ：(R,R)-Sertraline Hydrochloride;Sertraline EP Impurity G/Sertraline Enantiomer cis-Isomer
(1R,4R);1-Naphthalenamine,4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydro-N-methyl-, hydrochloride (1:1),(1R,4R)-;(1R,4R)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine,hydrochloride;Sertraline EP Impurity G HCl | | CAS: | 79645-15-1 | | MF: | C17H18Cl3N | | MW: | 342.69 | | EINECS: | | | Product Categories: | | | Mol File: | 79645-15-1.mol |  |
| | Sertraline EP Impurity G Chemical Properties |
| solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | BCS Class | 1 | | InChI | InChI=1/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17-;/s3 | | InChIKey | BLFQGGGGFNSJKA-TYIRTQGFNA-N | | SMILES | N([C@@H]1CC[C@H](C2C=CC(Cl)=C(Cl)C=2)C2=CC=CC=C12)C.Cl |&1:1,4,r| |
| | Sertraline EP Impurity G Usage And Synthesis |
| Uses | (R,R)-Sertraline Hydrochloride is the hydrochloride salt analogue of (R,R)-Sertraline (S279960), which acts as a selective serotonin reuptake inhibitor that displays minor antifungal activity as well. | | Veterinary Drugs and Treatments | Sertraline may be considered for use in treating a variety of behavior-
related diagnoses in dogs and cats, including aggression, and
anxiety-related or other obsessive-compulsive behaviors. |
| | Sertraline EP Impurity G Preparation Products And Raw materials |
|