|
| 2-[2-(DiMethylaMino)ethyl]-1-indanone Basic information |
| 2-[2-(DiMethylaMino)ethyl]-1-indanone Chemical Properties |
Boiling point | 302.3±11.0 °C(Predicted) | density | 1.054±0.06 g/cm3(Predicted) | storage temp. | -20°C Freezer | solubility | Chloroform (Slightly), Methanol (Slightly) | pka | 9.41±0.28(Predicted) | form | Red to Very Dark Red Semi-Solid | InChI | InChI=1S/C13H17NO/c1-14(2)8-7-11-9-10-5-3-4-6-12(10)13(11)15/h3-6,11H,7-9H2,1-2H3 | InChIKey | XJKFCKOAHVBKLL-UHFFFAOYSA-N | SMILES | C1(=O)C2=C(C=CC=C2)CC1CCN(C)C |
| 2-[2-(DiMethylaMino)ethyl]-1-indanone Usage And Synthesis |
Uses | Dimethindene impurity, a histaminic H1 receptor antagonist. |
| 2-[2-(DiMethylaMino)ethyl]-1-indanone Preparation Products And Raw materials |
|