|
| 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid Basic information |
Product Name: | 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid | Synonyms: | BOC-15-AMINO-4,7,10,13-TETRAOXAPENTADECANOIC ACID;15-(Boc-aMino)-4,7,10,13-tetraoxapentadecanoic acid;3-[2-[2-[2-[2-(tert-Butoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid 1-(1,1-dimethylethyl) ester;N-(tert-Butyloxycarbonyl)-15-amino-4,7,10,13-tetraoxapentanedecanoic acid;t-Boc-N-amido-PEG4-acid;T-BOC-NH-AMIDO-PEG4-COOH;15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid purum, >=97.0% (TLC) | CAS: | 756525-91-4 | MF: | C16H31NO8 | MW: | 365.42 | EINECS: | | Product Categories: | ADCs Linkers;PEG | Mol File: | 756525-91-4.mol |  |
| 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid Chemical Properties |
Boiling point | 504.5±50.0 °C(Predicted) | density | 1.124±0.06 g/cm3 (20 ºC 760 Torr) | storage temp. | 2-8°C | form | Oil | pka | 4.28±0.10(Predicted) | color | Colorless to light yellow | λmax | 254nm(lit.) | InChI | InChI=1S/C16H31NO8/c1-16(2,3)25-15(20)17-5-7-22-9-11-24-13-12-23-10-8-21-6-4-14(18)19/h4-13H2,1-3H3,(H,17,20)(H,18,19) | InChIKey | YCEYBRZRNOJORY-UHFFFAOYSA-N | SMILES | C(OC(C)(C)C)(=O)NCCOCCOCCOCCOCCC(O)=O |
Safety Statements | 24/25 | WGK Germany | 3 | HS Code | 29225090 |
| 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid Usage And Synthesis |
Description | t-Boc-N-amido-PEG4-acid is a PEG linker containing a terminal carboxylic acid and Boc-protected amino group. The hydrophilic PEG spacer increases solubility in aqueous media. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, HATU) to form a stable amide bond. The Boc group can be deprotected under mild acidic conditions to form the free amine. | Chemical Properties | Yellow oil | Uses | 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid is used as a substitution variant of cocaine esterase with improved stability and its use in treatment of cocaine overdose. | Reactivity Profile |
reagent type: cross-linking reagent, reaction type: Pegylations
| reaction suitability | reaction type: Pegylations reagent type: cross-linking reagent |
| 15-(Boc-amino)-4,7,10,13-tetraoxapentadecanoic acid Preparation Products And Raw materials |
|