|
|
| | 4-UNDECANOL Basic information |
| Product Name: | 4-UNDECANOL | | Synonyms: | 4-UNDECANOL 99%;4-Hendecanol;Heptylpropylcarbinol;undecan-4-ol;UNDECANOL-4;4-UNDECANOL | | CAS: | 4272-06-4 | | MF: | C11H24O | | MW: | 172.31 | | EINECS: | 224-264-3 | | Product Categories: | | | Mol File: | 4272-06-4.mol |  |
| | 4-UNDECANOL Chemical Properties |
| Melting point | 11.58°C (estimate) | | Boiling point | 80 °C / 2mmHg | | density | 0.83 | | refractive index | 1.4350 to 1.4370 | | Fp | 66 °C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C11H24O/c1-3-5-6-7-8-10-11(12)9-4-2/h11-12H,3-10H2,1-2H3 | | InChIKey | FNORHVDKJWGANC-UHFFFAOYSA-N | | SMILES | CCCC(O)CCCCCCC | | LogP | 4.249 (est) |
| | 4-UNDECANOL Usage And Synthesis |
| | 4-UNDECANOL Preparation Products And Raw materials |
|