| Company Name: |
Shanghai GL Peptide Ltd.
|
| Tel: |
+86-21-61263340; 17609490614 13764994101 |
| Email: |
fisherwang@glschina.com |
| Products Intro: |
Product Name:(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenyl}propanoic acid
CAS:1212895-19-6
Purity:95%;98%;99% Package:0.1g, 0.25g, 1g, 5g, 10g, 25g, 50g, 100g
|
|
| | BOC-D-2-AMINOMETHYLPHE(FMOC) Basic information |
| Product Name: | BOC-D-2-AMINOMETHYLPHE(FMOC) | | Synonyms: | Boc-2-(Fmoc-aminomethyl)-D-phenylalanine≥ 98% (HPLC, Chiral purity);Boc-2-(Fmoc-aminomethyl)-D-Phe-OH;Boc-D-Phe(2-CH2NHFmoc)-OH;BOC-D-2-AMINOMETHYLPHE(FMOC);(Tert-Butoxy)Carbonyl D-2-Aminomethylphe(Fmoc);(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-{2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]phenyl}propanoic acid;D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]-;N-α-(t-Butoxycarbonyl)-2-[(9-fluorenylmethoxycarbonyl)aminomethyl]-D-phenylalanine | | CAS: | 1212895-19-6 | | MF: | C30H32N2O6 | | MW: | 516.58 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | BOC-D-2-AMINOMETHYLPHE(FMOC) Chemical Properties |
| | BOC-D-2-AMINOMETHYLPHE(FMOC) Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-d-2-aminomethylphe(fmoc) is used as a reactant in the synthesis of second-generation DNA-templated macrocycle libraries. |
| | BOC-D-2-AMINOMETHYLPHE(FMOC) Preparation Products And Raw materials |
|