| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Bis(2-butoxyethyl) Phthalate-d4 Solution in Hexane, 1000μg/mL
CAS:1398065-96-7
Purity:1000μg/mL Package:1ml
|
| Company Name: |
Nanjing Haolv Biotechnology Co.,Ltd
|
| Tel: |
025-84622273 17361806303 |
| Email: |
3004208264@qq.com |
| Products Intro: |
Product Name:Bis(2-butoxyethyl) phthalate-3,4,5,6-d4
CAS:1398065-96-7
Purity:98%+ Package:5g;1g;500mg;100mg;25mg;10mg
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18501792038; 18501792038 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:Bis(2-butoxyethyl)phthalate-[D4
CAS:1398065-96-7
Purity:100ppm Package:100mg/L于正己烷，1.2ml Remarks:CDAA-S-320011D4-HA-1.2ml
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Bis(2-butoxyethyl) Phthalate-d4
CAS:1398065-96-7
Purity:NULL Package:100mg;10mg;25mg Remarks:NULL
|
|
| | Bis(2-butoxyethyl) Phthalate-d4 Basic information |
| Product Name: | Bis(2-butoxyethyl) Phthalate-d4 | | Synonyms: | Bis(2-butoxyethyl) Phthalate-d4;[2H4]-Bis (2-butoxyethyl) Phthalate;Bis(2-butoxyethyl) Phthalate-d4 Solution in Hexane, 1000μg/mL;Phthalic acid, bis-2-n-butoxyethyl ester D4 | | CAS: | 1398065-96-7 | | MF: | C6D4(COOCH2CH2OCH2CH2CH2CH3)2 | | MW: | 370.473247112 | | EINECS: | | | Product Categories: | | | Mol File: | 1398065-96-7.mol |  |
| | Bis(2-butoxyethyl) Phthalate-d4 Chemical Properties |
| storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless |
| | Bis(2-butoxyethyl) Phthalate-d4 Usage And Synthesis |
| Uses | Bis(2-butoxyethyl) Phthalate-d4 is labelled Bis(2-butoxyethyl) Phthalate (B415115), a plasticizer. |
| | Bis(2-butoxyethyl) Phthalate-d4 Preparation Products And Raw materials |
|