| Company Name: |
Bayee Biotech (Anqing) Co., Ltd. Gold
|
| Tel: |
0556-5032306 18917961636 |
| Email: |
wtx@bayeebio.com |
| Products Intro: |
Product Name:Difamilast
CAS:937782-05-3
Purity:99% Package:100g;1kg;10kg
|
Related articles - How is Difamilast synthesised?
- Difamilast is synthesised in two steps by chemical reaction using the monobenzylated protocatechuic acid ethyl ester as a raw ....
- Jan 17，2024
|
| | Difamilast Basic information |
| Product Name: | Difamilast | | Synonyms: | Difamilast 937782-05-3;Difamilast
(OPA-15406;OPA15406);Benzamide, N-[[2-[4-(difluoromethoxy)-3-(1-methylethoxy)phenyl]-4-oxazolyl]methyl]-2-ethoxy-;N-[[2-[4-(difluoromethoxy)-3-propan-2-yloxyphenyl]-1,3-oxazol-4-yl]methyl]-2-ethoxybenzamide;Difamilast,PDE4,OPA 15406,Inhibitor,atopic,phosphodiesterase-4,OPA15406,Phosphodiesterase (PDE),OPA-15406,dermatitis,subtype,inhibit;Difamilast;N-((2-(4-(difluoromethoxy)-3-isopropoxyphenyl)oxazol-4-yl)methyl)-2-ethoxybenzamide | | CAS: | 937782-05-3 | | MF: | C23H24F2N2O5 | | MW: | 446.44 | | EINECS: | | | Product Categories: | API | | Mol File: | 937782-05-3.mol |  |
| | Difamilast Chemical Properties |
| density | 1.223±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : 100 mg/mL (223.99 mM; Need ultrasonic) | | pka | 13.12±0.46(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C23H24F2N2O5/c1-4-29-18-8-6-5-7-17(18)21(28)26-12-16-13-30-22(27-16)15-9-10-19(32-23(24)25)20(11-15)31-14(2)3/h5-11,13-14,23H,4,12H2,1-3H3,(H,26,28) | | InChIKey | VFBILHPIHUPBPZ-UHFFFAOYSA-N | | SMILES | C(NCC1=COC(C2=CC=C(OC(F)F)C(OC(C)C)=C2)=N1)(=O)C1=CC=CC=C1OCC |
| | Difamilast Usage And Synthesis |
| Biological Activity | Difamilast is a novel atopic dermatitis drug candidate discovered by Otsuka that has phosphodiesterase 4 (PDE4) inhibitory activity. | | in vitro | Difamilast has particularly efficient inhibition of subtype B (IC50=11.2 nM). It (OPA-15406) improves skin condition in relevant animal models of AD. |
| | Difamilast Preparation Products And Raw materials |
|