|
|
| | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Basic information |
| Product Name: | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate | | Synonyms: | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate;Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate
Carbonic acid 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;,4-di-tert-butyl-5-nitrophenyl methyl carbonate;5-nitro-2,4-di-tert-butylphenyl methyl carbonate;2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester;2,4-Di-Tert-Butyl-5-Nitrophenyl;Carbonicacid, 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methy... | | CAS: | 873055-55-1 | | MF: | C16H23NO5 | | MW: | 309.36 | | EINECS: | | | Product Categories: | | | Mol File: | 873055-55-1.mol |  |
| | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Chemical Properties |
| Boiling point | 384℃ | | density | 1.110 | | Fp | 135℃ | | InChI | InChI=1S/C16H23NO5/c1-15(2,3)10-8-11(16(4,5)6)13(22-14(18)21-7)9-12(10)17(19)20/h8-9H,1-7H3 | | InChIKey | QBDLLAFFRJOLHZ-UHFFFAOYSA-N | | SMILES | C(OC)(=O)OC1=CC([N+]([O-])=O)=C(C(C)(C)C)C=C1C(C)(C)C |
| | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Usage And Synthesis |
| Uses | 5-Nitro-2,4-bis(1,1-dimethylethyl)phenyl-carbonic Acid Methyl Ester-d10 is an intermediate used in the synthesis of Ivacaftor (4-tertbutyl-d9) (Major) (I940603), which is isotopically labeled form of Ivacaftor (I940600), that is used in the treatment of cystic fibrosis. |
| | 2,4-di-tert-butyl-5-nitrophenyl methyl carbonate Preparation Products And Raw materials |
|