|
|
| | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid Basic information |
| Product Name: | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid | | Synonyms: | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid;(2S,5S)-5-hydroxypiperidine-2-carboxylic acid, 95%;2-Piperidinecarboxylic acid, 5-hydroxy-, (2S,5S)-;EOS-61524;(2S,5S)-1-(tert-butoxycarbonyl)-5-hydroxypiperidine-2-carboxylic acid;Relebactam intermediate;cis-5-Hydroxy-L-pipecolic Acid;L-cis-5-hydroxy-2-piperidinecarboxylic acid | | CAS: | 63088-78-8 | | MF: | C6H11NO3 | | MW: | 145.16 | | EINECS: | | | Product Categories: | | | Mol File: | 63088-78-8.mol |  |
| | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid Chemical Properties |
| Melting point | 258 °C | | Boiling point | 354.8±42.0 °C(Predicted) | | density | 1.299 | | storage temp. | 2-8°C(protect from light) | | form | powder to crystal | | pka | 2.31±0.40(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C6H11NO3/c8-4-1-2-5(6(9)10)7-3-4/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1 | | InChIKey | RKEYKDXXZCICFZ-WHFBIAKZSA-N | | SMILES | N1C[C@@H](O)CC[C@H]1C(O)=O |
| | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid Usage And Synthesis |
| Uses | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid is a useful intermediate for the synthesis of an agent and the like that inhibits β-lactamases in bacteria exhibiting the resistance against the β-lactam class of antibiotics, which β-lactamases are the major cause of the resistance in the bacteria. |
| | (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid Preparation Products And Raw materials |
|