|
|
| | 2-(4-Chlorophenoxy)phenylacetic acid Basic information |
| Product Name: | 2-(4-Chlorophenoxy)phenylacetic acid | | Synonyms: | 2-(4-Chlorophenoxy)phenylacetic acid;2-(2-(4-chlorophenoxy)phenyl)acetic acid;2-(4-chlorophenoxy)Benzeneacetic acid;orophenoxy)phenyL;Benzeneacetic acid, 2-(4-chlorophenoxy)- | | CAS: | 25563-04-6 | | MF: | C14H11ClO3 | | MW: | 262.69 | | EINECS: | | | Product Categories: | | | Mol File: | 25563-04-6.mol |  |
| | 2-(4-Chlorophenoxy)phenylacetic acid Chemical Properties |
| Melting point | 120-122℃ | | Boiling point | 397.7±27.0 °C(Predicted) | | density | 1.317 | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) | | pka | 4.10±0.10(Predicted) | | form | Solid | | color | Light Pinkish-Beige | | InChI | InChI=1S/C14H11ClO3/c15-11-5-7-12(8-6-11)18-13-4-2-1-3-10(13)9-14(16)17/h1-8H,9H2,(H,16,17) | | InChIKey | ALMJMOPIBISVHZ-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1OC1=CC=C(Cl)C=C1 |
| | 2-(4-Chlorophenoxy)phenylacetic acid Usage And Synthesis |
| Uses | 2-(2-(4-Chlorophenoxy)phenyl)acetic acid is used in the preparation of tri-substituted thiazoles as RAGE antagonists in Alzheimer treatments. |
| | 2-(4-Chlorophenoxy)phenylacetic acid Preparation Products And Raw materials |
|