| Company Name: |
Shanghai Acmec Biochemical Technology Co., Ltd. |
| Tel: |
+86-18621343501 |
| Email: |
product@acmec-e.com |
| Products Intro: |
Product Name:Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) CAS:162240-96-2 Purity:98% Package:1g
|
|
|
|
|
|
| | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) Basic information |
| Product Name: | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) | | Synonyms: | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI));Piperazine, 2,6-dimethyl-, hydrochloride (1:2), (2S,6S)-;Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI));(2S,6S)-2,6-Dimethylpiperazine-2HCl;PIPERAZINE, 2,6-DIMETHYL-, (HCL) (1:2), (2S,6S)- (OR PIPERAZINE, 2,6-DIMETHYL-, (2HCL), (2S-TRANS)- (9CI));(2S,6S)-2,6-dimethylpiperazine hydrogen chloride;dihydrochloride - [D72845];(2S,6S)-2,6-DiMethylpiperazine dihydrochloride | | CAS: | 162240-96-2 | | MF: | C6H15ClN2 | | MW: | 150.65 | | EINECS: | | | Product Categories: | | | Mol File: | 162240-96-2.mol |  |
| | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) Chemical Properties |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1/C6H14N2.ClH/c1-5-3-7-4-6(2)8-5;/h5-8H,3-4H2,1-2H3;1H/t5-,6-;/s3 | | InChIKey | VLTKHJPAZCPKEC-ATPDZTHWNA-N | | SMILES | C[C@H]1CNC[C@H](C)N1.Cl |&1:1,5,r| |
| | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) Usage And Synthesis |
| | Piperazine, 2,6-diMethyl-, (Hydrochloride) (1:2), (2S,6S)- (or Piperazine, 2,6-diMethyl-, (dihydrochloride), (2S-trans)- (9CI)) Preparation Products And Raw materials |
|