- Me-Diazirine-OH
-
- $0.00 / 1g
-
2024-04-02
- CAS:25055-82-7
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | 3-Azibutanol Basic information |
| Product Name: | 3-Azibutanol | | Synonyms: | 3,3-Azo-1-butanol;3-Azibutanol;3-Methyl-3H-diazirine-3-ethanol;2-(3-methyldiazirin-3-yl)ethanol;2-(3-Methyl-3H-diaziren-3-yl)ethanol;3H-Diazirine-3-ethanol, 3-methyl-;Me-Diazirine-OH;3-Azobutanol | | CAS: | 25055-82-7 | | MF: | C4H8N2O | | MW: | 100.12 | | EINECS: | | | Product Categories: | | | Mol File: | 25055-82-7.mol |  |
| | 3-Azibutanol Chemical Properties |
| Boiling point | 133.2±32.0℃ (760 Torr) | | density | 1.26±0.1 g/cm3 (20 ºC 760 Torr) | | Fp | 52.5±14.4℃ | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | color | Clear Colourless | | Stability: | Light Sensitive | | InChI | InChI=1S/C4H8N2O/c1-4(2-3-7)5-6-4/h7H,2-3H2,1H3 | | InChIKey | YXAYZDNOWMFZLL-UHFFFAOYSA-N | | SMILES | N1C(C)(CCO)N=1 |
| | 3-Azibutanol Usage And Synthesis |
| Uses | 3,3-Azo-1-butanol is used in the synthesis of Itraconazole (I937500) analogues for inhibition of endothelial cell proliferation, displaying antiangiogenic and antihedgehog activity. Also used in the synthesis of anticonvulsant methoxypropionamides. |
| | 3-Azibutanol Preparation Products And Raw materials |
|