|
| Methyl 4-amino-3-iodobenzoate Basic information |
| Methyl 4-amino-3-iodobenzoate Chemical Properties |
Melting point | 86-91 °C (lit.) | Boiling point | 369.6±32.0 °C(Predicted) | density | 1.826±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | pka | 0.41±0.10(Predicted) | form | Crystalline Powder | color | Beige | InChI | InChI=1S/C8H8INO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,10H2,1H3 | InChIKey | MRLVFVTVXSKAMX-UHFFFAOYSA-N | SMILES | C(OC)(=O)C1=CC=C(N)C(I)=C1 | CAS DataBase Reference | 19718-49-1(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36 | WGK Germany | 3 | HS Code | 29224985 |
| Methyl 4-amino-3-iodobenzoate Usage And Synthesis |
Definition | ChEBI: Methyl 4-amino-3-iodobenzoate is a benzoate ester. |
| Methyl 4-amino-3-iodobenzoate Preparation Products And Raw materials |
|