Gingerenone A manufacturers
- Gingerenone A
-
- $41.00 / 10mg
-
2024-11-13
- CAS:128700-97-0
- Min. Order:
- Purity: 98.94%
- Supply Ability: 10g
|
| | Gingerenone A Basic information |
| Product Name: | Gingerenone A | | Synonyms: | (E)-1,7-Bis(3-methoxy-4-hydroxyphenyl)-4-hepten-3-one;(E)-1,7-BIS(4-HYDROXY-3-METHOXYPHENYL)HEPT-4-EN-3-ONE;GINGERENONE A;4-Hepten-3-one, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (4E)-;1,7-bis(4-hydroxy-3-methoxyphenyl)hept-4-en-3-one | | CAS: | 128700-97-0 | | MF: | C21H24O5 | | MW: | 356.41 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Gingerenone A Chemical Properties |
| Boiling point | 571.3±50.0 °C(Predicted) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethanol (Slightly) | | form | Oil | | pka | 10.01±0.20(Predicted) | | color | Light Yellow to Yellow | | InChI | InChI=1S/C21H24O5/c1-25-20-13-15(8-11-18(20)23)5-3-4-6-17(22)10-7-16-9-12-19(24)21(14-16)26-2/h4,6,8-9,11-14,23-24H,3,5,7,10H2,1-2H3/b6-4+ | | InChIKey | FWDXZNKYDTXGOT-GQCTYLIASA-N | | SMILES | C(C1=CC=C(O)C(OC)=C1)CC(=O)/C=C/CCC1=CC=C(O)C(OC)=C1 |
| | Gingerenone A Usage And Synthesis |
| Uses | Gingerenone A is an antifungal and antiparasitic diarylheptenone that is isolated from Zingiber officinale (more commonly known as ginger), a medicinal plant that is used to treat inflammation and musculoskeletal disorders. | | Definition | ChEBI: Gingerenone A is a diarylheptanoid. |
| | Gingerenone A Preparation Products And Raw materials |
|