| Company Name: |
Porse Fine Chemical Co.,LTD
|
| Tel: |
20-66003216 18666003216 |
| Email: |
info@porsefinechemical.com |
| Products Intro: |
CAS:1626336-65-9
Purity:95%+ Remarks:1g
|
| Company Name: |
SuZhou ShiYa Biopharmaceuticals, Inc.
|
| Tel: |
0512-52358471 17715136450 |
| Email: |
sales@shiyabiopharm.com |
| Products Intro: |
Product Name:7-Bromo-4-chloro-1H-indazol-3-ylamine
CAS:1626336-65-9
Purity:95% Package:1g;5g Remarks:A1-2503A
|
| Company Name: |
Henan Aosman Biotechnology Co., LTD
|
| Tel: |
0371-61318675 17719817155 |
| Email: |
sales@xlinebio.com |
| Products Intro: |
Product Name:7-Bromo-4-chloro-1H-indazol-3-ylamine
CAS:1626336-65-9
Package:1kg
|
|
| | 7-Bromo-4-chloro-1H-indazol-3-ylamine Basic information |
| | 7-Bromo-4-chloro-1H-indazol-3-ylamine Chemical Properties |
| Boiling point | 453.4±40.0 °C(Predicted) | | density | 1.963±0.06 g/cm3(Predicted) | | pka | 11.54±0.40(Predicted) | | InChI | InChI=1S/C7H5BrClN3/c8-3-1-2-4(9)5-6(3)11-12-7(5)10/h1-2H,(H3,10,11,12) | | InChIKey | IQJRJSKDZJKCIW-UHFFFAOYSA-N | | SMILES | N1C2=C(C(Cl)=CC=C2Br)C(N)=N1 |
| | 7-Bromo-4-chloro-1H-indazol-3-ylamine Usage And Synthesis |
| | 7-Bromo-4-chloro-1H-indazol-3-ylamine Preparation Products And Raw materials |
|