|
| Nonylphenol, ethoxylated, phosphate, diethanolamine salt Basic information |
Product Name: | Nonylphenol, ethoxylated, phosphate, diethanolamine salt | Synonyms: | Ethanol, 2,2'-iminobis-, compd. with .alpha.-(nonylphenyl)-.omega.-hydroxypoly(oxy-1,2-ethanediyl) phosphate;Nonylphenol, ethoxylated, phosphate, diethanolamine salt | CAS: | 61837-81-8 | MF: | C4H11NO2.x(C2H4O)nC15H24O.xH3O4P | MW: | 0 | EINECS: | | Product Categories: | | Mol File: | Mol File | |
| Nonylphenol, ethoxylated, phosphate, diethanolamine salt Chemical Properties |
| Nonylphenol, ethoxylated, phosphate, diethanolamine salt Usage And Synthesis |
| Nonylphenol, ethoxylated, phosphate, diethanolamine salt Preparation Products And Raw materials |
|