| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 |
| Email: |
info@amateksci.com |
| Products Intro: |
Product Name:N-(3-Chloro-4-nitrophenyl)acetamide
CAS:712-33-4
Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
Suzhou Devi Pharma Technology Co., Ltd.
|
| Tel: |
0512-66565816 18651107528 |
| Email: |
|
| Products Intro: |
Product Name:N-(3-chloro-4-nitrophenyl)acetamide
CAS:712-33-4
Purity:97% Package:25g; 100g; 1kg
|
|
| | N-{3-chloro-4-nitrophenyl}acetamide Basic information |
| Product Name: | N-{3-chloro-4-nitrophenyl}acetamide | | Synonyms: | N-{3-chloro-4-nitrophenyl}acetamide;3'-Chloro-4'-nitroacetanilide;N-(4-Nitro-3-chlorophenyl)acetamide;N-(3-Chloro-4-nitrophenyl)acetamide, 4-Acetamido-2-chloronitrobenzene;Acetamide, N-(3-chloro-4-nitrophenyl)- | | CAS: | 712-33-4 | | MF: | C8H7ClN2O3 | | MW: | 214.61 | | EINECS: | | | Product Categories: | | | Mol File: | 712-33-4.mol |  |
| | N-{3-chloro-4-nitrophenyl}acetamide Chemical Properties |
| Melting point | 145 °C(Solv: benzene (71-43-2)) | | Boiling point | 428.3±35.0 °C(Predicted) | | density | 1.466±0.06 g/cm3(Predicted) | | pka | 13.24±0.70(Predicted) |
| | N-{3-chloro-4-nitrophenyl}acetamide Usage And Synthesis |
| | N-{3-chloro-4-nitrophenyl}acetamide Preparation Products And Raw materials |
|