|
| 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea Basic information |
Product Name: | 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea | Synonyms: | 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea;N-(2-chloro-4-hydroxyphenyl)-N'-cyclopropyl-Urea;Urea, N-(2-chloro-4-hydroxyphenyl)-N'-cyclopropyl-;Lenvatinib Impurity a;(Z)-N-(2-chloro-4-hydroxyphenyl)-N-cyclopropylcarbamimidic acid;lenvaint-I;Lenvatinib Impurity LFS-A;(2-Chloro-4-hydroxyphenyl)-N'-cyclopropyl- urea | CAS: | 796848-79-8 | MF: | C10H11ClN2O2 | MW: | 226.66 | EINECS: | | Product Categories: | | Mol File: | 796848-79-8.mol | |
| 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea Chemical Properties |
Boiling point | 364.6±42.0 °C(Predicted) | density | 1.43±0.1 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | DMSO (Slightly), Methanol (Slightly) | pka | 9.37±0.31(Predicted) | form | Solid | color | Off-White to Light Beige | InChI | InChI=1S/C10H11ClN2O2/c11-8-5-7(14)3-4-9(8)13-10(15)12-6-1-2-6/h3-6,14H,1-2H2,(H2,12,13,15) | InChIKey | QVPZNUIZEVRITP-UHFFFAOYSA-N | SMILES | N(C1=CC=C(O)C=C1Cl)C(NC1CC1)=O |
| 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea Usage And Synthesis |
Uses | Desquinolinyl Lenvatinib is a metabolite of Lenvatinib (L329400) which is an orally active inhibitor of multiple receptor tyrosine kinases including VEGF, FGF and SCF receptors. |
| 1-(2-chloro-4-hydroxyphenyl)-3-cyclopropylurea Preparation Products And Raw materials |
|