|
|
| | GSK2256294A Basic information |
| Product Name: | GSK2256294A | | Synonyms: | GSK2256294A;GSK 2256294;GSK-2256294;GSK2256294;GSK-2256294A;GSK2256294A;GSK 2256294A - GSK 2256294;Cyclohexanecarboxamide, N-[[4-cyano-2-(trifluoromethyl)phenyl]methyl]-3-[[4-methyl-6-(methylamino)-1,3,5-triazin-2-yl]amino]-, (1R,3S)-;GSK-2256294,GSK-2256294A,GSK2256294A,Inhibitor,Epoxide Hydrolase,GSK2256294,inhibit,cigarette smoke-exposure model,oral,COPD,cardiovascular,inflammation;(1R,3S)-N-(4-Cyano-2-(trifluoromethyl)benzyl)-3-((4-methyl-6-(methylamino)-1,3,5-triazin-2-yl)amino)cyclohexane-1-carboxamide | | CAS: | 1142090-23-0 | | MF: | C21H24F3N7O | | MW: | 447.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1142090-23-0.mol |  |
| | GSK2256294A Chemical Properties |
| density | 1.34±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO : ≥ 47 mg/mL (105.04 mM) | | form | Solid | | pka | 14.75±0.40(Predicted) | | color | White to off-white | | InChIKey | LQHDJQIMETZMPH-ZBFHGGJFSA-N | | SMILES | [C@@H]1(C(NCC2=CC=C(C#N)C=C2C(F)(F)F)=O)CCC[C@H](NC2=NC(C)=NC(NC)=N2)C1 |
| | GSK2256294A Usage And Synthesis |
| Uses | GSK 2256294 is used in pharmacokinetics, pharmacodynamics and adverse event profile of novel soluble epoxide hydrolase inhibitor GSK2256294 in human against sEH enzyme activity. |
| | GSK2256294A Preparation Products And Raw materials |
|