|
| [2,2'-Binaphthalene]-1,1',4,4'-tetrone Basic information |
| [2,2'-Binaphthalene]-1,1',4,4'-tetrone Chemical Properties |
InChI | InChI=1S/C20H10O4/c21-17-9-15(19(23)13-7-3-1-5-11(13)17)16-10-18(22)12-6-2-4-8-14(12)20(16)24/h1-10H | InChIKey | QWYZAMKNTSAAPN-UHFFFAOYSA-N | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C=C1C1=CC(=O)C2=C(C1=O)C=CC=C2 |
| [2,2'-Binaphthalene]-1,1',4,4'-tetrone Usage And Synthesis |
Uses | 2,2''-Bis(p-naphthoquinone) is a compound that on contact with human spermatozoa induce a state of "spermostasis," characterized by the extremely rapid inhibition of sperm movement without compromising cell viability, and can be possibly used for providing simultaneous defense against both fertility and the spread of sexually transmitted disease. |
| [2,2'-Binaphthalene]-1,1',4,4'-tetrone Preparation Products And Raw materials |
|