HS-1793 manufacturers
- HS-1793
-
- $43.00 / 5mg
-
2024-11-19
- CAS:927885-00-5
- Min. Order:
- Purity: 99.86%
- Supply Ability: 10g
|
| HS-1793 Basic information |
Product Name: | HS-1793 | Synonyms: | HS-1793;HIF-1α,Inhibitor,MCF-7,HS 1793,breast cancer,inhibit,ERK,HCT116,resveratrol,VEGF,Apoptosis,HS-1793,Akt,colon cancer,HS1793;1,3-Benzenediol, 4-(6-hydroxy-2-naphthalenyl)- | CAS: | 927885-00-5 | MF: | C16H12O3 | MW: | 252.26 | EINECS: | | Product Categories: | | Mol File: | 927885-00-5.mol | |
| HS-1793 Chemical Properties |
Melting point | 186 °C | Boiling point | 520.8±19.0 °C(Predicted) | density | 1.370±0.06 g/cm3(Predicted) | pka | 9.31±0.35(Predicted) | form | Solid | color | Off-white to light yellow | InChI | InChI=1S/C16H12O3/c17-13-4-3-10-7-12(2-1-11(10)8-13)15-6-5-14(18)9-16(15)19/h1-9,17-19H | InChIKey | BXZJBSHLEZAMOP-UHFFFAOYSA-N | SMILES | C1(O)=CC=C(C2=CC=C3C(=C2)C=CC(O)=C3)C(O)=C1 |
| HS-1793 Usage And Synthesis |
| HS-1793 Preparation Products And Raw materials |
|