|
| TED-347 Basic information |
Product Name: | TED-347 | Synonyms: | TED-347;Ethanone, 2-chloro-1-[2-[[3-(trifluoromethyl)phenyl]amino]phenyl]-;TED-347 2-Chloro-1-(2-((3-(trifluoromethyl)phenyl)amino)-phenyl)ethan-1-one;PPI,irreversible,protein-protein,YAP,allosteric,TEAD4?Yap1,transcriptional,glioblastoma,TED 347,YAP-TEAD,TEAD4,inhibit,Yes-associated protein,covalent,Yap1,antitumor,Inhibitor,TED-347,TED347,TEAD,interaction,Cys-367 | CAS: | 2378626-29-8 | MF: | C15H11ClF3NO | MW: | 313.7 | EINECS: | | Product Categories: | | Mol File: | 2378626-29-8.mol | ![TED-347 Structure](CAS/20200611/GIF/2378626-29-8.gif) |
| TED-347 Chemical Properties |
Boiling point | 378.0±42.0 °C(Predicted) | density | 1.352±0.06 g/cm3(Predicted) | pka | -2.67±0.50(Predicted) | form | Solid | color | Light yellow to green yellow | InChI | InChI=1S/C15H11ClF3NO/c16-9-14(21)12-6-1-2-7-13(12)20-11-5-3-4-10(8-11)15(17,18)19/h1-8,20H,9H2 | InChIKey | JPVDFGYNLUBCSD-UHFFFAOYSA-N | SMILES | C(=O)(C1=CC=CC=C1NC1=CC=CC(C(F)(F)F)=C1)CCl |
| TED-347 Usage And Synthesis |
| TED-347 Preparation Products And Raw materials |
|