|
|
| | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Basic information |
| Product Name: | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol | | Synonyms: | 1-(4-HYDROXYPHENYL)-4-(4-NITROPHENYL)-PIPERAZINE;4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol;4-(4-(4-nitrophenyl)piperazin-1-yl)phenol;4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenol;4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Itraconazole interMediate;Posaconazole impurity NPPY;1-(4-Nitrophenyl)-4-(4-hydroxyphenyl)piperazine;Phenol, 4-[4-(4-nitrophenyl)-1-piperazinyl]- | | CAS: | 112559-81-6 | | MF: | C16H17N3O3 | | MW: | 299.32 | | EINECS: | 601-189-8 | | Product Categories: | Heterocyclic Compounds | | Mol File: | 112559-81-6.mol |  |
| | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Chemical Properties |
| Melting point | >90°C (dec.) | | Boiling point | 540.8±50.0 °C(Predicted) | | density | 1.317±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly, Heated) | | pka | 12.18±0.30(Predicted) | | form | Solid | | color | Yellow to Brown | | InChI | InChI=1S/C16H17N3O3/c20-16-7-5-14(6-8-16)18-11-9-17(10-12-18)13-1-3-15(4-2-13)19(21)22/h1-8,20H,9-12H2 | | InChIKey | BNHYDULILNJFFY-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N2CCN(C3=CC=C([N+]([O-])=O)C=C3)CC2)C=C1 | | CAS DataBase Reference | 112559-81-6(CAS DataBase Reference) |
| | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Usage And Synthesis |
| Uses | 4-[4-(4-Nitrophenyl)-1-piperazinyl]phenol is a key intermediate in the synthesis of triazole medicines, such as itraconazole (I937500), which are used in curing deep department fungal infections. Inhibitor of endothelial cell proliferation. |
| | 4-(4-(4-Nitrophenyl)-1-piperazinyl)phenol Preparation Products And Raw materials |
|