| Company Name: |
Shanghai Latchem Co., Ltd.
|
| Tel: |
021-61916491 15921747686 |
| Email: |
sales@latcheminc.com |
| Products Intro: |
CAS:89544-38-7
Purity:95% HPLC Package:1G/5G/10G/50G Remarks:latch-0497
|
| Company Name: |
Nanjing Bic Biotechnology Co., Ltd
|
| Tel: |
025-58906079 17352406906 |
| Email: |
sales@bicbiotech.com |
| Products Intro: |
Product Name:Methanone, bis(5-chloro-2-pyridinyl)-
CAS:89544-38-7
Purity:95% Package:100mg;500mg
|
|
| | Methanone, bis(5-chloro-2-pyridinyl)- Basic information |
| | Methanone, bis(5-chloro-2-pyridinyl)- Chemical Properties |
| Boiling point | 395.2±42.0 °C(Predicted) | | density | 1.422±0.06 g/cm3(Predicted) | | pka | -0.36±0.10(Predicted) |
| | Methanone, bis(5-chloro-2-pyridinyl)- Usage And Synthesis |
| | Methanone, bis(5-chloro-2-pyridinyl)- Preparation Products And Raw materials |
|