|
|
| | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane Basic information |
| Product Name: | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane | | Synonyms: | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane;6-Benzylamino-1-(4'-phenylbutoxy)hexane;N-[6-(4-Phenylbutoxy)hexyl]benzenemethanamine;[6-(4-Phenylbutoxy)hexyl]benzylamine;Benzenemethanamine, N-[6-(4-phenylbutoxy)hexyl]- oxalate;Salmeterol Intermediates;Benzenemethanamine,N-[6-(4-phenylbutoxy)hexyl]-;N-[6-(4-phenylbutoxy)hexyl]-benzenemethanamine, oxalate | | CAS: | 97664-55-6 | | MF: | C23H33NO | | MW: | 339.51 | | EINECS: | 692-628-2 | | Product Categories: | | | Mol File: | 97664-55-6.mol |  |
| | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane Chemical Properties |
| Boiling point | 467.2±38.0 °C(Predicted) | | density | 0.979±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | pka | 9.76±0.19(Predicted) | | form | Oil | | color | Pale Yellow to Brown | | InChI | InChI=1S/C23H33NO/c1(10-18-24-21-23-16-7-4-8-17-23)2-11-19-25-20-12-9-15-22-13-5-3-6-14-22/h3-8,13-14,16-17,24H,1-2,9-12,15,18-21H2 | | InChIKey | JWLIKZBRVQRFNF-UHFFFAOYSA-N | | SMILES | C1(CNCCCCCCOCCCCC2=CC=CC=C2)=CC=CC=C1 |
| | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane Usage And Synthesis |
| Chemical Properties | Yellow Oil | | Uses | Intermediate in the preparation of Salmeterol (S090100). |
| | 6-N-Benzylamino-1-(4'-phenylbutoxy)Hexane Preparation Products And Raw materials |
|