|
| 5-Formylpyrrole-2-carboxylic acid methyl ester Basic information |
Product Name: | 5-Formylpyrrole-2-carboxylic acid methyl ester | Synonyms: | 5-Formylpyrrole-2-carboxylic acid methyl ester;Methyl5-formylpyrrole-2-carboxylate;1H-Pyrrole-2-carboxylic acid, 5-formyl-, methyl ester;Inchi=1/C7H7no3/C1-11-7(10)6-3-2-5(4-9)8-6/H2-4,8H,1h;5-Formyl-1H-pyrrole-2-carboxylic acid methyl ester;Methyl 5-formyl-1H-pyrrole-2-carboxylate | CAS: | 1197-13-3 | MF: | C7H7NO3 | MW: | 153.14 | EINECS: | | Product Categories: | Building Blocks;Pyrrole | Mol File: | 1197-13-3.mol | ![5-Formylpyrrole-2-carboxylic acid methyl ester Structure](CAS/GIF/1197-13-3.gif) |
| 5-Formylpyrrole-2-carboxylic acid methyl ester Chemical Properties |
Melting point | 96 °C | Boiling point | 313.2±27.0 °C(Predicted) | density | 1.305±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | pka | 13.36±0.50(Predicted) |
| 5-Formylpyrrole-2-carboxylic acid methyl ester Usage And Synthesis |
Uses | Methyl 5-formylpyrrole-2-carboxylate |
| 5-Formylpyrrole-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|