|
|
| | triisopropylsilyl Methacrylate Basic information |
| Product Name: | triisopropylsilyl Methacrylate | | Synonyms: | triisopropylsilyl Methacrylate;2-Methyl-2-propenoic acid tris(1-methylethyl)silyl ester;2-Propenoic acid, 2-methyl-, tris(1-methylethyl)silyl ester;TISMA;tri(propan-2-yl)silyl 2-methylprop-2-enoate;Triisopropylsilyl Methacrylate (TISMA);ri(propan-2-yl)silyl2-methylprop-2-enoate;DK521 | | CAS: | 134652-60-1 | | MF: | C13H26O2Si | | MW: | 242.43 | | EINECS: | 700-182-8 | | Product Categories: | | | Mol File: | 134652-60-1.mol |  |
| | triisopropylsilyl Methacrylate Chemical Properties |
| Boiling point | 249.6±9.0 °C(Predicted) | | density | 0.870±0.06 g/cm3(Predicted) | | vapor pressure | 3.9-5.1hPa at 20-25℃ | | InChI | InChI=1S/C13H26O2Si/c1-9(2)13(14)15-16(10(3)4,11(5)6)12(7)8/h10-12H,1H2,2-8H3 | | InChIKey | KNNOZYMZRGTZQM-UHFFFAOYSA-N | | SMILES | C(O[Si](C(C)C)(C(C)C)C(C)C)(=O)C(C)=C | | LogP | 6.5 |
| | triisopropylsilyl Methacrylate Usage And Synthesis |
| Chemical Properties | Colorless Transparent Liquid |
| | triisopropylsilyl Methacrylate Preparation Products And Raw materials |
|